C30H35N7O3 — CID 144509700
(E)-1-[3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-4-[methyl(oxetan-3-yl)amino]but-2-en-1-one (PubChem CID 144509700) has the molecular formula C30H35N7O3 and a molecular weight of 541.66 g/mol. Its IUPAC name is (E)-1-[3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-4-[methyl(oxetan-3-yl)amino]but-2-en-1-one.
| Compound Name | (E)-1-[3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-4-[methyl(oxetan-3-yl)amino]but-2-en-1-one |
|---|---|
| PubChem CID | 144509700 |
| Molecular Formula | C30H35N7O3 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | (E)-1-[3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]piperidin-1-yl]-4-[methyl(oxetan-3-yl)amino]but-2-en-1-one |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1NC1CCCN(C(=O)/C=C/CN(C)C2COC2)C1 |
| InChI | InChI=1S/C30H35N7O3/c1-36(23-18-39-19-23)15-6-10-26(38)37-16-5-7-22(17-37)35-30-27(29(32)33-20-34-30)28(31)21-11-13-25(14-12-21)40-24-8-3-2-4-9-24/h2-4,6,8-14,20,22-23,31H,5,7,15-19H2,1H3,(H3,32,33,34,35)/b10-6+,31-28+ |
| InChIKey | HGPKRYSCPWMSPA-HKIYKRRZSA-N |
| XLogP | 3.56 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|