C30H32N8O2 — CID 144509665
(E)-1-[(3R)-3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-4-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]but-2-en-1-one (PubChem CID 144509665) has the molecular formula C30H32N8O2 and a molecular weight of 536.64 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-4-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]but-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-4-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]but-2-en-1-one |
|---|---|
| PubChem CID | 144509665 |
| Molecular Formula | C30H32N8O2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (E)-1-[(3R)-3-[[6-amino-5-(4-phenoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidin-1-yl]-4-[[(1Z)-1-(methylideneamino)buta-1,3-dienyl]amino]but-2-en-1-one |
| SMILES | [H]/N=C(\c1ccc(Oc2ccccc2)cc1)c1c(N)ncnc1N[C@@H]1CCN(C(=O)/C=C/CN/C(=C/C=C)N=C)C1 |
| InChI | InChI=1S/C30H32N8O2/c1-3-8-25(33-2)34-17-7-11-26(39)38-18-16-22(19-38)37-30-27(29(32)35-20-36-30)28(31)21-12-14-24(15-13-21)40-23-9-5-4-6-10-23/h3-15,20,22,31,34H,1-2,16-19H2,(H3,32,35,36,37)/b11-7+,25-8+,31-28+/t22-/m1/s1 |
| InChIKey | DEXVCPXSPKZIBH-AJTXTVGYSA-N |
| XLogP | 4.15 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|