C25H27N6O2+ — CID 143651368
[[4-amino-6-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidin-5-yl]-(4-phenoxyphenyl)methylidene]azanium (PubChem CID 143651368) has the molecular formula C25H27N6O2+ and a molecular weight of 443.53 g/mol. Its IUPAC name is [[4-amino-6-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidin-5-yl]-(4-phenoxyphenyl)methylidene]azanium.
| Compound Name | [[4-amino-6-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidin-5-yl]-(4-phenoxyphenyl)methylidene]azanium |
|---|---|
| PubChem CID | 143651368 |
| Molecular Formula | C25H27N6O2+ |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | [[4-amino-6-[(1-prop-2-enoylpiperidin-3-yl)amino]pyrimidin-5-yl]-(4-phenoxyphenyl)methylidene]azanium |
| SMILES | C=CC(=O)N1CCCC(Nc2ncnc(N)c2C(=[NH2+])c2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H26N6O2/c1-2-21(32)31-14-6-7-18(15-31)30-25-22(24(27)28-16-29-25)23(26)17-10-12-20(13-11-17)33-19-8-4-3-5-9-19/h2-5,8-13,16,18,26H,1,6-7,14-15H2,(H3,27,28,29,30)/p+1 |
| InChIKey | TXSMSKQTLONCDW-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|