C28H26N4O2 — CID 134264899
1-[3-[4-amino-6-(4-phenoxyphenyl)quinazolin-8-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 134264899) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-[3-[4-amino-6-(4-phenoxyphenyl)quinazolin-8-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-6-(4-phenoxyphenyl)quinazolin-8-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134264899 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-[3-[4-amino-6-(4-phenoxyphenyl)quinazolin-8-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(c2cc(-c3ccc(Oc4ccccc4)cc3)cc3c(N)ncnc23)C1 |
| InChI | InChI=1S/C28H26N4O2/c1-2-26(33)32-14-6-7-20(17-32)24-15-21(16-25-27(24)30-18-31-28(25)29)19-10-12-23(13-11-19)34-22-8-4-3-5-9-22/h2-5,8-13,15-16,18,20H,1,6-7,14,17H2,(H2,29,30,31) |
| InChIKey | ONAQEERZRFHNEM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|