C24H23N7O2 — CID 139465193
1-[3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 139465193) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139465193 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)nc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C24H23N7O2/c1-2-20(32)30-12-6-7-17(14-30)31-24-21(23(25)27-15-28-24)22(29-31)16-10-11-19(26-13-16)33-18-8-4-3-5-9-18/h2-5,8-11,13,15,17H,1,6-7,12,14H2,(H2,25,27,28) |
| InChIKey | KFOLDLQDAYZNSJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|