C31H28N6O2 — CID 169098733
1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 169098733) has the molecular formula C31H28N6O2 and a molecular weight of 516.61 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 169098733 |
| Molecular Formula | C31H28N6O2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2C1CCCN(C(=O)C=Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H28N6O2/c32-30-28-29(23-14-16-26(17-15-23)39-25-11-5-2-6-12-25)35-37(31(28)34-21-33-30)24-10-7-19-36(20-24)27(38)18-13-22-8-3-1-4-9-22/h1-6,8-9,11-18,21,24H,7,10,19-20H2,(H2,32,33,34) |
| InChIKey | HLUFLVMCLDSYPT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|