C29H26N6O3 — CID 169098730
1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 169098730) has the molecular formula C29H26N6O3 and a molecular weight of 506.57 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 169098730 |
| Molecular Formula | C29H26N6O3 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2C1CCCN(C(=O)C=Cc2ccco2)C1 |
| InChI | InChI=1S/C29H26N6O3/c30-28-26-27(20-10-12-24(13-11-20)38-23-7-2-1-3-8-23)33-35(29(26)32-19-31-28)21-6-4-16-34(18-21)25(36)15-14-22-9-5-17-37-22/h1-3,5,7-15,17,19,21H,4,6,16,18H2,(H2,30,31,32) |
| InChIKey | HAASVQUHVORUJC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|