C30H33N7O3 — CID 71208638
1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(oxolan-3-ylamino)but-2-en-1-one (PubChem CID 71208638) has the molecular formula C30H33N7O3 and a molecular weight of 539.64 g/mol. Its IUPAC name is 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(oxolan-3-ylamino)but-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(oxolan-3-ylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 71208638 |
| Molecular Formula | C30H33N7O3 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 1-[3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-(oxolan-3-ylamino)but-2-en-1-one |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2C1CCCN(C(=O)C=CCNC2CCOC2)C1 |
| InChI | InChI=1S/C30H33N7O3/c31-29-27-28(21-10-12-25(13-11-21)40-24-7-2-1-3-8-24)35-37(30(27)34-20-33-29)23-6-5-16-36(18-23)26(38)9-4-15-32-22-14-17-39-19-22/h1-4,7-13,20,22-23,32H,5-6,14-19H2,(H2,31,33,34) |
| InChIKey | MFMLICMRORSZOE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|