C32H37N7O3 — CID 71208659
1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-[methyl(oxan-4-yl)amino]but-2-en-1-one (PubChem CID 71208659) has the molecular formula C32H37N7O3 and a molecular weight of 567.70 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-[methyl(oxan-4-yl)amino]but-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-[methyl(oxan-4-yl)amino]but-2-en-1-one |
|---|---|
| PubChem CID | 71208659 |
| Molecular Formula | C32H37N7O3 |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-4-[methyl(oxan-4-yl)amino]but-2-en-1-one |
| SMILES | CN(CC=CC(=O)N1CCC[C@H](C1)N2C3=NC=NC(=C3C(=N2)C4=CC=C(C=C4)OC5=CC=CC=C5)N)C6CCOCC6 |
| InChI | InChI=1S/C32H37N7O3/c1-37(24-15-19-41-20-16-24)17-6-10-28(40)38-18-5-7-25(21-38)39-32-29(31(33)34-22-35-32)30(36-39)23-11-13-27(14-12-23)42-26-8-3-2-4-9-26/h2-4,6,8-14,22,24-25H,5,7,15-21H2,1H3,(H2,33,34,35)/t25-/m1/s1 |
| InChIKey | OMMKHOLDSBMFLV-RUZDIDTESA-N |
| XLogP | 3.70 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | 887 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|