C31H35N7O2 — CID 71208457
(E)-1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-4-(cyclohexylamino)but-2-en-1-one (PubChem CID 71208457) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-4-(cyclohexylamino)but-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-4-(cyclohexylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 71208457 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | (E)-1-[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-4-(cyclohexylamino)but-2-en-1-one |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2[C@@H]1CCN(C(=O)/C=C/CNC2CCCCC2)C1 |
| InChI | InChI=1S/C31H35N7O2/c32-30-28-29(22-13-15-26(16-14-22)40-25-10-5-2-6-11-25)36-38(31(28)35-21-34-30)24-17-19-37(20-24)27(39)12-7-18-33-23-8-3-1-4-9-23/h2,5-7,10-16,21,23-24,33H,1,3-4,8-9,17-20H2,(H2,32,34,35)/b12-7+/t24-/m1/s1 |
| InChIKey | JVPSKYCDSAOWMN-KGUVVTLUSA-N |
| XLogP | 5.12 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|