C20H19F3N6O2 — CID 71450151
1-[(3R)-3-[4-amino-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 71450151) has the molecular formula C20H19F3N6O2 and a molecular weight of 432.41 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71450151 |
| Molecular Formula | C20H19F3N6O2 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-[4-(trifluoromethoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(OC(F)(F)F)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C20H19F3N6O2/c1-2-15(30)28-9-3-4-13(10-28)29-19-16(18(24)25-11-26-19)17(27-29)12-5-7-14(8-6-12)31-20(21,22)23/h2,5-8,11,13H,1,3-4,9-10H2,(H2,24,25,26)/t13-/m1/s1 |
| InChIKey | ZMBSAKQLOAAWCL-CYBMUJFWSA-N |
| XLogP | 3.32 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|