C33H38N10O2 — CID 175242784
2-[(3R)-3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enenitrile (PubChem CID 175242784) has the molecular formula C33H38N10O2 and a molecular weight of 606.74 g/mol. Its IUPAC name is 2-[(3R)-3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enenitrile.
| Compound Name | 2-[(3R)-3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enenitrile |
|---|---|
| PubChem CID | 175242784 |
| Molecular Formula | C33H38N10O2 |
| Molecular Weight | 606.74 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 2-[(3R)-3-[4-amino-3-(6-phenoxy-3-pyridinyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-4-methyl-4-(4-methylpiperazin-1-yl)pent-2-enenitrile |
| SMILES | CN1CCN(C(C)(C)C=C(C#N)C(=O)N2CCC[C@@H](n3nc(-c4ccc(Oc5ccccc5)nc4)c4c(N)ncnc43)C2)CC1 |
| InChI | InChI=1S/C33H38N10O2/c1-33(2,42-16-14-40(3)15-17-42)18-24(19-34)32(44)41-13-7-8-25(21-41)43-31-28(30(35)37-22-38-31)29(39-43)23-11-12-27(36-20-23)45-26-9-5-4-6-10-26/h4-6,9-12,18,20,22,25H,7-8,13-17,21H2,1-3H3,(H2,35,37,38)/t25-/m1/s1 |
| InChIKey | MZHLLUKOSUBMDR-RUZDIDTESA-N |
| XLogP | 3.90 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|