C28H24F2N8O2 — CID 175373048
2-[3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile (PubChem CID 175373048) has the molecular formula C28H24F2N8O2 and a molecular weight of 542.55 g/mol. Its IUPAC name is 2-[3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile.
| Compound Name | 2-[3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
|---|---|
| PubChem CID | 175373048 |
| Molecular Formula | C28H24F2N8O2 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 2-[3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-cyclopropylprop-2-enenitrile |
| SMILES | N#CC(=CC1CC1)C(=O)N1CCCC(n2nc(-c3ccc(Oc4c(F)cccc4F)nc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C28H24F2N8O2/c29-20-4-1-5-21(30)25(20)40-22-9-8-17(13-33-22)24-23-26(32)34-15-35-27(23)38(36-24)19-3-2-10-37(14-19)28(39)18(12-31)11-16-6-7-16/h1,4-5,8-9,11,13,15-16,19H,2-3,6-7,10,14H2,(H2,32,34,35) |
| InChIKey | PUUHADKDKRVIFQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|