C31H28F3N9O2 — CID 71043207
1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 71043207) has the molecular formula C31H28F3N9O2 and a molecular weight of 615.62 g/mol. Its IUPAC name is 1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 71043207 |
| Molecular Formula | C31H28F3N9O2 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | 1-[4-[4-amino-1-[(3R)-1-[(E)-2-cyano-3-cyclopropylprop-2-enoyl]piperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | N#C/C(=C\C1CC1)C(=O)N1CCC[C@@H](n2nc(-c3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C31H28F3N9O2/c32-31(33,34)21-3-1-4-23(14-21)40-30(45)39-22-10-8-19(9-11-22)26-25-27(36)37-17-38-28(25)43(41-26)24-5-2-12-42(16-24)29(44)20(15-35)13-18-6-7-18/h1,3-4,8-11,13-14,17-18,24H,2,5-7,12,16H2,(H2,36,37,38)(H2,39,40,45)/b20-13+/t24-/m1/s1 |
| InChIKey | JVOKWRXYCFEVTR-WKDXJHLXSA-N |
| XLogP | 5.76 |
| TPSA | 154.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|