C32H32N8O — CID 159964808
(Z)-1-[(3R)-3-[4-amino-3-[4-[1-(4-methylphenyl)ethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one (PubChem CID 159964808) has the molecular formula C32H32N8O and a molecular weight of 544.66 g/mol. Its IUPAC name is (Z)-1-[(3R)-3-[4-amino-3-[4-[1-(4-methylphenyl)ethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one.
| Compound Name | (Z)-1-[(3R)-3-[4-amino-3-[4-[1-(4-methylphenyl)ethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one |
|---|---|
| PubChem CID | 159964808 |
| Molecular Formula | C32H32N8O |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | (Z)-1-[(3R)-3-[4-amino-3-[4-[1-(4-methylphenyl)ethenylamino]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\C1CC1)C(=O)N1CCC[C@@H](n2nc(-c3ccc(NC(=C)c4ccc(C)cc4)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C32H32N8O/c1-20-6-10-23(11-7-20)21(2)37-25-14-12-24(13-15-25)29-28-30(33)35-19-36-31(28)40(38-29)26-5-4-16-39(18-26)32(41)27(34-3)17-22-8-9-22/h6-7,10-15,17,19,22,26,37H,2,4-5,8-9,16,18H2,1H3,(H2,33,35,36)/b27-17-/t26-/m1/s1 |
| InChIKey | XZGBZSQUAUCFMS-OZVJIIIZSA-N |
| XLogP | 5.84 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|