C30H29F2N7O2 — CID 161241899
1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one;methane (PubChem CID 161241899) has the molecular formula C30H29F2N7O2 and a molecular weight of 557.61 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one;methane.
| Compound Name | 1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one;methane |
|---|---|
| PubChem CID | 161241899 |
| Molecular Formula | C30H29F2N7O2 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one;methane |
| SMILES | C.[C-]#[N+]C(=CC1CC1)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4c(F)cccc4F)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C29H25F2N7O2.CH4/c1-33-23(14-17-7-8-17)29(39)37-13-3-4-19(15-37)38-28-24(27(32)34-16-35-28)25(36-38)18-9-11-20(12-10-18)40-26-21(30)5-2-6-22(26)31;/h2,5-6,9-12,14,16-17,19H,3-4,7-8,13,15H2,(H2,32,34,35);1H4/t19-;/m1./s1 |
| InChIKey | VACUUUUJGQXJDJ-FSRHSHDFSA-N |
| XLogP | 6.16 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|