C29H27N7O2 — CID 123554387
(Z)-1-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one (PubChem CID 123554387) has the molecular formula C29H27N7O2 and a molecular weight of 505.58 g/mol. Its IUPAC name is (Z)-1-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one.
| Compound Name | (Z)-1-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one |
|---|---|
| PubChem CID | 123554387 |
| Molecular Formula | C29H27N7O2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (Z)-1-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\C1CC1)C(=O)N1CCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C29H27N7O2/c1-31-24(17-19-7-8-19)29(37)35-15-13-21(14-16-35)36-28-25(27(30)32-18-33-28)26(34-36)20-9-11-23(12-10-20)38-22-5-3-2-4-6-22/h2-6,9-12,17-19,21H,7-8,13-16H2,(H2,30,32,33)/b24-17- |
| InChIKey | UQIMUQWFKZSPKR-ULJHMMPZSA-N |
| XLogP | 5.24 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|