C28H28N6O2 — CID 174716641
[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-ethenylcyclopropyl)methanone (PubChem CID 174716641) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is [4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-ethenylcyclopropyl)methanone.
| Compound Name | [4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-ethenylcyclopropyl)methanone |
|---|---|
| PubChem CID | 174716641 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-ethenylcyclopropyl)methanone |
| SMILES | C=CC1CC1C(=O)N1CCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C28H28N6O2/c1-2-18-16-23(18)28(35)33-14-12-20(13-15-33)34-27-24(26(29)30-17-31-27)25(32-34)19-8-10-22(11-9-19)36-21-6-4-3-5-7-21/h2-11,17-18,20,23H,1,12-16H2,(H2,29,30,31) |
| InChIKey | MQISIUFGVUUCBI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|