C31H33N7O2 — CID 123431413
(Z)-N-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide (PubChem CID 123431413) has the molecular formula C31H33N7O2 and a molecular weight of 535.65 g/mol. Its IUPAC name is (Z)-N-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide.
| Compound Name | (Z)-N-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 123431413 |
| Molecular Formula | C31H33N7O2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | (Z)-N-[4-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide |
| SMILES | [C-]#[N+]/C(=C\C(C)(C)C)C(=O)NC1CCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C31H33N7O2/c1-31(2,3)18-25(33-4)30(39)36-21-12-14-22(15-13-21)38-29-26(28(32)34-19-35-29)27(37-38)20-10-16-24(17-11-20)40-23-8-6-5-7-9-23/h5-11,16-19,21-22H,12-15H2,1-3H3,(H,36,39)(H2,32,34,35)/b25-18- |
| InChIKey | GDFVGEAXGDOMJX-BWAHOGKJSA-N |
| XLogP | 6.32 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|