C33H36ClN7O3 — CID 161455123
(Z)-N-[4-[4-amino-3-[4-(3-chloro-4-methylphenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide (PubChem CID 161455123) has the molecular formula C33H36ClN7O3 and a molecular weight of 614.15 g/mol. Its IUPAC name is (Z)-N-[4-[4-amino-3-[4-(3-chloro-4-methylphenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide.
| Compound Name | (Z)-N-[4-[4-amino-3-[4-(3-chloro-4-methylphenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 161455123 |
| Molecular Formula | C33H36ClN7O3 |
| Molecular Weight | 614.15 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | (Z)-N-[4-[4-amino-3-[4-(3-chloro-4-methylphenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]-2-isocyano-4,4-dimethylpent-2-enamide |
| SMILES | [C-]#[N+]/C(=C\C(C)(C)C)C(=O)NC1CCC(n2nc(-c3ccc(Oc4ccc(C)c(Cl)c4)c(OC)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C33H36ClN7O3/c1-19-7-13-23(16-24(19)34)44-26-14-8-20(15-27(26)43-6)29-28-30(35)37-18-38-31(28)41(40-29)22-11-9-21(10-12-22)39-32(42)25(36-5)17-33(2,3)4/h7-8,13-18,21-22H,9-12H2,1-4,6H3,(H,39,42)(H2,35,37,38)/b25-17- |
| InChIKey | XLBWTJLVLWIEDB-UQQQWYQISA-N |
| XLogP | 7.29 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.15 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|