C21H19ClFN7O — CID 122695191
1-(1-chloropiperidin-3-yl)-3-[6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 122695191) has the molecular formula C21H19ClFN7O and a molecular weight of 439.88 g/mol. Its IUPAC name is 1-(1-chloropiperidin-3-yl)-3-[6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(1-chloropiperidin-3-yl)-3-[6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 122695191 |
| Molecular Formula | C21H19ClFN7O |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 1-(1-chloropiperidin-3-yl)-3-[6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3F)nc1)nn2C1CCCN(Cl)C1 |
| InChI | InChI=1S/C21H19ClFN7O/c22-29-9-3-4-14(11-29)30-21-18(20(24)26-12-27-21)19(28-30)13-7-8-17(25-10-13)31-16-6-2-1-5-15(16)23/h1-2,5-8,10,12,14H,3-4,9,11H2,(H2,24,26,27) |
| InChIKey | WADSVBLUBAZAIT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|