C23H19F2N7O2 — CID 134531728
1-[(3R)-3-[4-amino-3-[2-fluoro-6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 134531728) has the molecular formula C23H19F2N7O2 and a molecular weight of 463.45 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-[2-fluoro-6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-[2-fluoro-6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134531728 |
| Molecular Formula | C23H19F2N7O2 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-[2-fluoro-6-(2-fluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](n2nc(-c3ccc(Oc4ccccc4F)nc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C23H19F2N7O2/c1-2-18(33)31-10-9-13(11-31)32-23-19(22(26)27-12-28-23)20(30-32)14-7-8-17(29-21(14)25)34-16-6-4-3-5-15(16)24/h2-8,12-13H,1,9-11H2,(H2,26,27,28)/t13-/m1/s1 |
| InChIKey | LWPTZHDPCDOWSW-CYBMUJFWSA-N |
| XLogP | 3.50 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|