C18H17FN6O2 — CID 136930729
1-[(3R)-3-[4-amino-3-(2-fluoro-4-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 136930729) has the molecular formula C18H17FN6O2 and a molecular weight of 368.37 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-(2-fluoro-4-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-(2-fluoro-4-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 136930729 |
| Molecular Formula | C18H17FN6O2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-(2-fluoro-4-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](n2nc(-c3ccc(O)cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C18H17FN6O2/c1-2-14(27)24-6-5-10(8-24)25-18-15(17(20)21-9-22-18)16(23-25)12-4-3-11(26)7-13(12)19/h2-4,7,9-10,26H,1,5-6,8H2,(H2,20,21,22)/t10-/m1/s1 |
| InChIKey | FFPNTHXBLJJVEP-SNVBAGLBSA-N |
| XLogP | 1.88 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|