C24H26FN5O4 — CID 155003496
4-[[6-amino-5-[4-(2-fluoro-3-methoxyphenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]cyclohexane-1,2-diol (PubChem CID 155003496) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is 4-[[6-amino-5-[4-(2-fluoro-3-methoxyphenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]cyclohexane-1,2-diol.
| Compound Name | 4-[[6-amino-5-[4-(2-fluoro-3-methoxyphenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 155003496 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-[[6-amino-5-[4-(2-fluoro-3-methoxyphenoxy)benzenecarboximidoyl]pyrimidin-4-yl]amino]cyclohexane-1,2-diol |
| SMILES | [H]/N=C(\c1ccc(Oc2cccc(OC)c2F)cc1)c1c(N)ncnc1NC1CCC(O)C(O)C1 |
| InChI | InChI=1S/C24H26FN5O4/c1-33-18-3-2-4-19(21(18)25)34-15-8-5-13(6-9-15)22(26)20-23(27)28-12-29-24(20)30-14-7-10-16(31)17(32)11-14/h2-6,8-9,12,14,16-17,26,31-32H,7,10-11H2,1H3,(H3,27,28,29,30)/b26-22+ |
| InChIKey | HHKWIKYKNOCBNG-XTCLZLMSSA-N |
| XLogP | 3.10 |
| TPSA | 146.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|