C20H27N7O2 — CID 88960620
tert-butyl (3R)-3-[[6-amino-5-(4-aminobenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 88960620) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[6-amino-5-(4-aminobenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[6-amino-5-(4-aminobenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88960620 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | tert-butyl (3R)-3-[[6-amino-5-(4-aminobenzenecarboximidoyl)pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C(\c1ccc(N)cc1)c1c(N)ncnc1N[C@@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H27N7O2/c1-20(2,3)29-19(28)27-9-8-14(10-27)26-18-15(17(23)24-11-25-18)16(22)12-4-6-13(21)7-5-12/h4-7,11,14,22H,8-10,21H2,1-3H3,(H3,23,24,25,26)/b22-16+/t14-/m1/s1 |
| InChIKey | AQDWQNAQICBRAL-TYIKUYDASA-N |
| XLogP | 2.48 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|