C15H24N6O2 — CID 126660696
tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 126660696) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126660696 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C(\C)c1c(N)ncnc1NC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H24N6O2/c1-9(16)11-12(17)18-8-19-13(11)20-10-5-6-21(7-10)14(22)23-15(2,3)4/h8,10,16H,5-7H2,1-4H3,(H3,17,18,19,20)/b16-9+ |
| InChIKey | WBWHVZWIKKLAQZ-CXUHLZMHSA-N |
| XLogP | 1.87 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|