C20H38N6O2 — CID 145011201
tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate;ethane (PubChem CID 145011201) has the molecular formula C20H38N6O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145011201 |
| Molecular Formula | C20H38N6O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | tert-butyl 3-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H26N6O2.2C2H6/c1-10(17)12-13(18)19-9-20-14(12)21-11-6-5-7-22(8-11)15(23)24-16(2,3)4;2*1-2/h9,11,17H,5-8H2,1-4H3,(H3,18,19,20,21);2*1-2H3/b17-10+;; |
| InChIKey | XHCYXEGIBCLJEL-PHPLCDBTSA-N |
| XLogP | 4.31 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|