C19H26N4O2 — CID 71212336
tert-butyl (3R)-3-[(3-aminoquinolin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 71212336) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(3-aminoquinolin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(3-aminoquinolin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71212336 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | tert-butyl (3R)-3-[(3-aminoquinolin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Nc2c(N)cnc3ccccc23)C1 |
| InChI | InChI=1S/C19H26N4O2/c1-19(2,3)25-18(24)23-10-6-7-13(12-23)22-17-14-8-4-5-9-16(14)21-11-15(17)20/h4-5,8-9,11,13H,6-7,10,12,20H2,1-3H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | DAERAMUCJWRQKZ-CYBMUJFWSA-N |
| XLogP | 3.63 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |