C17H23N3 — CID 103963377
4-N-(3,4-dimethylcyclohexyl)quinoline-3,4-diamine (PubChem CID 103963377) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-N-(3,4-dimethylcyclohexyl)quinoline-3,4-diamine.
| Compound Name | 4-N-(3,4-dimethylcyclohexyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103963377 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-N-(3,4-dimethylcyclohexyl)quinoline-3,4-diamine |
| SMILES | CC1CCC(Nc2c(N)cnc3ccccc23)CC1C |
| InChI | InChI=1S/C17H23N3/c1-11-7-8-13(9-12(11)2)20-17-14-5-3-4-6-16(14)19-10-15(17)18/h3-6,10-13H,7-9,18H2,1-2H3,(H,19,20) |
| InChIKey | NIXYJULMUVMGKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |