C15H20N2S — CID 66354450
N-(3,4-dimethylcyclohexyl)-2,1-benzothiazol-3-amine (PubChem CID 66354450) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-2,1-benzothiazol-3-amine.
| Compound Name | N-(3,4-dimethylcyclohexyl)-2,1-benzothiazol-3-amine |
|---|---|
| PubChem CID | 66354450 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-2,1-benzothiazol-3-amine |
| SMILES | CC1CCC(Nc2snc3ccccc23)CC1C |
| InChI | InChI=1S/C15H20N2S/c1-10-7-8-12(9-11(10)2)16-15-13-5-3-4-6-14(13)17-18-15/h3-6,10-12,16H,7-9H2,1-2H3 |
| InChIKey | VYCIBQXKXYOFFQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |