C12H20N4 — CID 64740867
2-N-(3,4-dimethylcyclohexyl)pyrimidine-2,5-diamine (PubChem CID 64740867) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-N-(3,4-dimethylcyclohexyl)pyrimidine-2,5-diamine.
| Compound Name | 2-N-(3,4-dimethylcyclohexyl)pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 64740867 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 2-N-(3,4-dimethylcyclohexyl)pyrimidine-2,5-diamine |
| SMILES | CC1CCC(Nc2ncc(N)cn2)CC1C |
| InChI | InChI=1S/C12H20N4/c1-8-3-4-11(5-9(8)2)16-12-14-6-10(13)7-15-12/h6-9,11H,3-5,13H2,1-2H3,(H,14,15,16) |
| InChIKey | BZVCYRRSMHQBRU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |