C14H23N3 — CID 83266556
2-N-(3,4-dimethylcyclohexyl)-5-methylpyridine-2,4-diamine (PubChem CID 83266556) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-N-(3,4-dimethylcyclohexyl)-5-methylpyridine-2,4-diamine.
| Compound Name | 2-N-(3,4-dimethylcyclohexyl)-5-methylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 83266556 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-N-(3,4-dimethylcyclohexyl)-5-methylpyridine-2,4-diamine |
| SMILES | Cc1cnc(NC2CCC(C)C(C)C2)cc1N |
| InChI | InChI=1S/C14H23N3/c1-9-4-5-12(6-10(9)2)17-14-7-13(15)11(3)8-16-14/h7-10,12H,4-6H2,1-3H3,(H3,15,16,17) |
| InChIKey | ZOQBXQVSMLKKRR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |