C11H18N4 — CID 61147383
2-N-cycloheptylpyrimidine-2,5-diamine (PubChem CID 61147383) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-N-cycloheptylpyrimidine-2,5-diamine.
| Compound Name | 2-N-cycloheptylpyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 61147383 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-N-cycloheptylpyrimidine-2,5-diamine |
| SMILES | Nc1cnc(NC2CCCCCC2)nc1 |
| InChI | InChI=1S/C11H18N4/c12-9-7-13-11(14-8-9)15-10-5-3-1-2-4-6-10/h7-8,10H,1-6,12H2,(H,13,14,15) |
| InChIKey | CGBUZNRYBFSGJH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |