About 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine
4-N-(2-methylcyclopropyl)quinoline-3,4-diamine (PubChem CID 103963223) has the molecular formula C13H15N3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine.
Molecular Properties
| Compound Name | 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine |
| PubChem CID | 103963223 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine |
| SMILES | CC1CC1Nc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C13H15N3/c1-8-6-12(8)16-13-9-4-2-3-5-11(9)15-7-10(13)14/h2-5,7-8,12H,6,14H2,1H3,(H,15,16) |
| InChIKey | RWMSOQLPFUJGHD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine?
The IUPAC name of 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine (CID 103963223) is 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine.
What is the SMILES notation for 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine?
The canonical SMILES for 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine is CC1CC1Nc1c(N)cnc2ccccc12.
What is the InChIKey of 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine?
The InChIKey is RWMSOQLPFUJGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3/c1-8-6-12(8)16-13-9-4-2-3-5-11(9)15-7-10(13)14/h2-5,7-8,12H,6,14H2,1H3,(H,15,16).
What are the key properties of 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine?
4-N-(2-methylcyclopropyl)quinoline-3,4-diamine has a molecular weight of 213.28 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-methylcyclopropyl)quinoline-3,4-diamine is sourced from PubChem (CID 103963223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).