C17H15N3O — CID 103963345
4-N-(2,3-dihydro-1-benzofuran-3-yl)quinoline-3,4-diamine (PubChem CID 103963345) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 4-N-(2,3-dihydro-1-benzofuran-3-yl)quinoline-3,4-diamine.
| Compound Name | 4-N-(2,3-dihydro-1-benzofuran-3-yl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103963345 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-N-(2,3-dihydro-1-benzofuran-3-yl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NC1COc2ccccc21 |
| InChI | InChI=1S/C17H15N3O/c18-13-9-19-14-7-3-1-6-12(14)17(13)20-15-10-21-16-8-4-2-5-11(15)16/h1-9,15H,10,18H2,(H,19,20) |
| InChIKey | KKNQJIQWNLXMOD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |