C15H19N3 — CID 103962725
4-N-cyclohexylquinoline-3,4-diamine (PubChem CID 103962725) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-N-cyclohexylquinoline-3,4-diamine.
| Compound Name | 4-N-cyclohexylquinoline-3,4-diamine |
|---|---|
| PubChem CID | 103962725 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-N-cyclohexylquinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NC1CCCCC1 |
| InChI | InChI=1S/C15H19N3/c16-13-10-17-14-9-5-4-8-12(14)15(13)18-11-6-2-1-3-7-11/h4-5,8-11H,1-3,6-7,16H2,(H,17,18) |
| InChIKey | PTEFUOIUGPJMGE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |