C13H15N3O2S — CID 103962744
4-N-(1,1-dioxothiolan-3-yl)quinoline-3,4-diamine (PubChem CID 103962744) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-N-(1,1-dioxothiolan-3-yl)quinoline-3,4-diamine.
| Compound Name | 4-N-(1,1-dioxothiolan-3-yl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 103962744 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-N-(1,1-dioxothiolan-3-yl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccccc2c1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15N3O2S/c14-11-7-15-12-4-2-1-3-10(12)13(11)16-9-5-6-19(17,18)8-9/h1-4,7,9H,5-6,8,14H2,(H,15,16) |
| InChIKey | VZVXZAOLUTXEDP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |