C20H26N4O2S — CID 112880169
6-N-cyclohexyl-4-N-(1,1-dioxothiolan-3-yl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880169) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 6-N-cyclohexyl-4-N-(1,1-dioxothiolan-3-yl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-cyclohexyl-4-N-(1,1-dioxothiolan-3-yl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880169 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 6-N-cyclohexyl-4-N-(1,1-dioxothiolan-3-yl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | O=S1(=O)CCC(Nc2cc(NC3CCCCC3)nc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C20H26N4O2S/c25-27(26)12-11-17(14-27)22-19-13-18(21-16-9-5-2-6-10-16)23-20(24-19)15-7-3-1-4-8-15/h1,3-4,7-8,13,16-17H,2,5-6,9-12,14H2,(H2,21,22,23,24) |
| InChIKey | PGNYLVQXFNTXSU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |