C16H19N3O — CID 71031794
N-cyclopentyl-6-methoxy-2-phenylpyrimidin-4-amine (PubChem CID 71031794) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is N-cyclopentyl-6-methoxy-2-phenylpyrimidin-4-amine.
| Compound Name | N-cyclopentyl-6-methoxy-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 71031794 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-cyclopentyl-6-methoxy-2-phenylpyrimidin-4-amine |
| SMILES | COc1cc(NC2CCCC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H19N3O/c1-20-15-11-14(17-13-9-5-6-10-13)18-16(19-15)12-7-3-2-4-8-12/h2-4,7-8,11,13H,5-6,9-10H2,1H3,(H,17,18,19) |
| InChIKey | LXEOPPLCVXRGRC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |