C19H24N4O2S — CID 112934436
2-N-cyclopentyl-4-N-(1,1-dioxothiolan-3-yl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112934436) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-N-cyclopentyl-4-N-(1,1-dioxothiolan-3-yl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclopentyl-4-N-(1,1-dioxothiolan-3-yl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112934436 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-N-cyclopentyl-4-N-(1,1-dioxothiolan-3-yl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | O=S1(=O)CCC(Nc2cc(-c3ccccc3)nc(NC3CCCC3)n2)C1 |
| InChI | InChI=1S/C19H24N4O2S/c24-26(25)11-10-16(13-26)20-18-12-17(14-6-2-1-3-7-14)22-19(23-18)21-15-8-4-5-9-15/h1-3,6-7,12,15-16H,4-5,8-11,13H2,(H2,20,21,22,23) |
| InChIKey | NUMLDYVIFGVJJL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |