C20H28N4 — CID 112933540
4-N-butyl-2-N-cyclohexyl-6-phenylpyrimidine-2,4-diamine (PubChem CID 112933540) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 4-N-butyl-2-N-cyclohexyl-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-2-N-cyclohexyl-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933540 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 4-N-butyl-2-N-cyclohexyl-6-phenylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1cc(-c2ccccc2)nc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C20H28N4/c1-2-3-14-21-19-15-18(16-10-6-4-7-11-16)23-20(24-19)22-17-12-8-5-9-13-17/h4,6-7,10-11,15,17H,2-3,5,8-9,12-14H2,1H3,(H2,21,22,23,24) |
| InChIKey | DDVDCJUKMOCUET-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|