C23H27N5 — CID 112937172
4-N-cycloheptyl-6-phenyl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112937172) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-phenyl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-cycloheptyl-6-phenyl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112937172 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 4-N-cycloheptyl-6-phenyl-2-N-(pyridin-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | c1ccc(-c2cc(NC3CCCCCC3)nc(NCc3ccccn3)n2)cc1 |
| InChI | InChI=1S/C23H27N5/c1-2-7-13-19(12-6-1)26-22-16-21(18-10-4-3-5-11-18)27-23(28-22)25-17-20-14-8-9-15-24-20/h3-5,8-11,14-16,19H,1-2,6-7,12-13,17H2,(H2,25,26,27,28) |
| InChIKey | MCNVZVZTEILKRD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |