C21H23N5 — CID 112934432
2-N-cyclopentyl-6-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112934432) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-N-cyclopentyl-6-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclopentyl-6-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112934432 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 2-N-cyclopentyl-6-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | c1ccc(-c2cc(NCc3cccnc3)nc(NC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C21H23N5/c1-2-8-17(9-3-1)19-13-20(23-15-16-7-6-12-22-14-16)26-21(25-19)24-18-10-4-5-11-18/h1-3,6-9,12-14,18H,4-5,10-11,15H2,(H2,23,24,25,26) |
| InChIKey | AGDUZQRMWXWNTJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |