C18H26N4 — CID 112933581
4-N-butyl-2-N-tert-butyl-6-phenylpyrimidine-2,4-diamine (PubChem CID 112933581) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-N-butyl-2-N-tert-butyl-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-2-N-tert-butyl-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933581 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 4-N-butyl-2-N-tert-butyl-6-phenylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1cc(-c2ccccc2)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C18H26N4/c1-5-6-12-19-16-13-15(14-10-8-7-9-11-14)20-17(21-16)22-18(2,3)4/h7-11,13H,5-6,12H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | DDHLFCNDEKOVNF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|