C24H30N4O — CID 112935198
2-N-(4-tert-butylphenyl)-4-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112935198) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-N-(4-tert-butylphenyl)-4-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-tert-butylphenyl)-4-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112935198 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-N-(4-tert-butylphenyl)-4-N-(3-methoxypropyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | COCCCNc1cc(-c2ccccc2)nc(Nc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C24H30N4O/c1-24(2,3)19-11-13-20(14-12-19)26-23-27-21(18-9-6-5-7-10-18)17-22(28-23)25-15-8-16-29-4/h5-7,9-14,17H,8,15-16H2,1-4H3,(H2,25,26,27,28) |
| InChIKey | RIPHEHHYXCPWPW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|