C20H20N4O3 — CID 112934961
2-N-(1,3-benzodioxol-5-yl)-4-N-(2-methoxyethyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112934961) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-yl)-4-N-(2-methoxyethyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-yl)-4-N-(2-methoxyethyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112934961 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-yl)-4-N-(2-methoxyethyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | COCCNc1cc(-c2ccccc2)nc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C20H20N4O3/c1-25-10-9-21-19-12-16(14-5-3-2-4-6-14)23-20(24-19)22-15-7-8-17-18(11-15)27-13-26-17/h2-8,11-12H,9-10,13H2,1H3,(H2,21,22,23,24) |
| InChIKey | HEFLMKYBSFVBNK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|