C15H18N4O3 — CID 112869604
4-N-(1,3-benzodioxol-5-yl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 112869604) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112869604 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | COCCNc1cc(Nc2ccc3c(c2)OCO3)nc(C)n1 |
| InChI | InChI=1S/C15H18N4O3/c1-10-17-14(16-5-6-20-2)8-15(18-10)19-11-3-4-12-13(7-11)22-9-21-12/h3-4,7-8H,5-6,9H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | MJDNEBYBPWUDSR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|