C13H14N4O2 — CID 80759901
4-N-(1,3-benzodioxol-5-yl)-6-N,2-dimethylpyrimidine-4,6-diamine (PubChem CID 80759901) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-6-N,2-dimethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-6-N,2-dimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80759901 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-6-N,2-dimethylpyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2ccc3c(c2)OCO3)nc(C)n1 |
| InChI | InChI=1S/C13H14N4O2/c1-8-15-12(14-2)6-13(16-8)17-9-3-4-10-11(5-9)19-7-18-10/h3-6H,7H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | BZVVCBIGLDZPEX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |