C22H26N4 — CID 112933555
2-N-benzyl-4-N-butyl-2-N-methyl-6-phenylpyrimidine-2,4-diamine (PubChem CID 112933555) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-N-benzyl-4-N-butyl-2-N-methyl-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-butyl-2-N-methyl-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933555 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2-N-benzyl-4-N-butyl-2-N-methyl-6-phenylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1cc(-c2ccccc2)nc(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H26N4/c1-3-4-15-23-21-16-20(19-13-9-6-10-14-19)24-22(25-21)26(2)17-18-11-7-5-8-12-18/h5-14,16H,3-4,15,17H2,1-2H3,(H,23,24,25) |
| InChIKey | QSMVPJGOKNGTAD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|