C13H23N5 — CID 112939878
5-N-butyl-3-N-cyclohexyl-1,2,4-triazine-3,5-diamine (PubChem CID 112939878) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 5-N-butyl-3-N-cyclohexyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-butyl-3-N-cyclohexyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112939878 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 5-N-butyl-3-N-cyclohexyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCCNc1cnnc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C13H23N5/c1-2-3-9-14-12-10-15-18-13(17-12)16-11-7-5-4-6-8-11/h10-11H,2-9H2,1H3,(H2,14,16,17,18) |
| InChIKey | RZNRGYMGADJSGQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|